4-AcO-DMT: Difference between revisions

From TripSit wiki
Jump to navigation Jump to search
(Created page with "{{DISPLAYTITLE:''O''-Acetylpsilocin}} {{Drugbox | verifiedrevid = 447612407 | IUPAC_name = 3-[2-(Dimethylamino)ethyl]-1''H''-indol-4-yl acetate | Image:O-Acetylpsilocin.jpg|...")
 
No edit summary
Line 1: Line 1:
{{DISPLAYTITLE:''O''-Acetylpsilocin}}
{{DISPLAYTITLE:''O''-Acetylpsilocin}}
{{Drugbox
| verifiedrevid = 447612407
| IUPAC_name = 3-[2-(Dimethylamino)ethyl]-1''H''-indol-4-yl acetate
| [[Image:O-Acetylpsilocin.jpg|225px|right]]


<!--Clinical data-->
[[Image:O-Acetylpsilocin.jpg|225px|right]]
| tradename = 
| legal_CA = Unscheduled
| legal_US = <br/>Unscheduled
| legal_status = <br/>May be considered Illegal if intended for human consumption
| routes_of_administration = Oral, IV, intranasal, rectal


<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 92292-84-7
| ATC_prefix = none
| PubChem = 15429212
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21106357
<!--Chemical data-->
| C=14 | H=18 | N=2 | O=2
| molecular_weight = 246.3049 g/mol
| smiles = CC(=O)Oc2cccc1ncc(CCN(C)C)c12
| InChI = 1/C14H18N2O2/c1-10(17)18-13-6-4-5-12-14(13)11(9-15-12)7-8-16(2)3/h4-6,9,15H,7-8H2,1-3H3
| InChIKey = RTLRUOSYLFOFHV-UHFFFAOYAA
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H18N2O2/c1-10(17)18-13-6-4-5-12-14(13)11(9-15-12)7-8-16(2)3/h4-6,9,15H,7-8H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RTLRUOSYLFOFHV-UHFFFAOYSA-N
| synonyms = 4-acetoxy-''N,N''-dimethyltryptamine, 3-(2'-dimethylaminoethyl)-4-acetoxy-indole<ref name="Esters of Indoles">{{ cite patent | country = US | number = 3075992 | status = patent | title = Esters of indoles | inventor = Hofmann A, Troxler F | assign1 = Sandoz Ltd. }}</ref>
| melting_point = 172
| melting_high = 173
}}


'''O-Acetylpsilocin''' (also known as '''Psilacetin''', '''4-Acetoxy-DMT''', or '''4-AcO-DMT''') is a synthetically produced psychoactive drug with a limited history of use. Its effects and duration are similar to those of psilocybin/psilocin although it is sometimes described as "warmer" or "more euphoric" than psilocybin-containing mushrooms. It is probably metabolically converted into psilocin in the body, but there are also reasons to believe that 4-acetoxy-DMT might itself be active in the brain, producing effects that are distinct from psilocin.
'''O-Acetylpsilocin''' (also known as '''Psilacetin''', '''4-Acetoxy-DMT''', or '''4-AcO-DMT''') is a synthetically produced psychoactive drug with a limited history of use. Its effects and duration are similar to those of psilocybin/psilocin although it is sometimes described as "warmer" or "more euphoric" than psilocybin-containing mushrooms. It is probably metabolically converted into psilocin in the body, but there are also reasons to believe that 4-acetoxy-DMT might itself be active in the brain, producing effects that are distinct from psilocin.

Revision as of 05:37, 19 July 2014



O-Acetylpsilocin (also known as Psilacetin, 4-Acetoxy-DMT, or 4-AcO-DMT) is a synthetically produced psychoactive drug with a limited history of use. Its effects and duration are similar to those of psilocybin/psilocin although it is sometimes described as "warmer" or "more euphoric" than psilocybin-containing mushrooms. It is probably metabolically converted into psilocin in the body, but there are also reasons to believe that 4-acetoxy-DMT might itself be active in the brain, producing effects that are distinct from psilocin.

Retrieved from "http://wiki.tripsit.me/index.php?title=4-AcO-DMT&oldid=3160"